C16H26ClN3O — CID 102990923
2-amino-3-chloro-N-[3-(diethylamino)propyl]-N-ethylbenzamide (PubChem CID 102990923) has the molecular formula C16H26ClN3O and a molecular weight of 311.86 g/mol. Its IUPAC name is 2-amino-3-chloro-N-[3-(diethylamino)propyl]-N-ethylbenzamide.
| Compound Name | 2-amino-3-chloro-N-[3-(diethylamino)propyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 102990923 |
| Molecular Formula | C16H26ClN3O |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 2-amino-3-chloro-N-[3-(diethylamino)propyl]-N-ethylbenzamide |
| SMILES | CCN(CC)CCCN(CC)C(=O)c1cccc(Cl)c1N |
| InChI | InChI=1S/C16H26ClN3O/c1-4-19(5-2)11-8-12-20(6-3)16(21)13-9-7-10-14(17)15(13)18/h7,9-10H,4-6,8,11-12,18H2,1-3H3 |
| InChIKey | MHJJDXPKYRZNGR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|