C16H26N2O3 — CID 102993947
N-[3-(diethylamino)propyl]-N-ethyl-2,3-dihydroxybenzamide (PubChem CID 102993947) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-N-ethyl-2,3-dihydroxybenzamide.
| Compound Name | N-[3-(diethylamino)propyl]-N-ethyl-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 102993947 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N-[3-(diethylamino)propyl]-N-ethyl-2,3-dihydroxybenzamide |
| SMILES | CCN(CC)CCCN(CC)C(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C16H26N2O3/c1-4-17(5-2)11-8-12-18(6-3)16(21)13-9-7-10-14(19)15(13)20/h7,9-10,19-20H,4-6,8,11-12H2,1-3H3 |
| InChIKey | KZKIIBWXUDBXOF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|