C14H18INO3 — CID 145020440
N-butyl-2,3-dihydroxy-N-(2-iodoprop-2-enyl)benzamide (PubChem CID 145020440) has the molecular formula C14H18INO3 and a molecular weight of 375.21 g/mol. Its IUPAC name is N-butyl-2,3-dihydroxy-N-(2-iodoprop-2-enyl)benzamide.
| Compound Name | N-butyl-2,3-dihydroxy-N-(2-iodoprop-2-enyl)benzamide |
|---|---|
| PubChem CID | 145020440 |
| Molecular Formula | C14H18INO3 |
| Molecular Weight | 375.21 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | N-butyl-2,3-dihydroxy-N-(2-iodoprop-2-enyl)benzamide |
| SMILES | C=C(I)CN(CCCC)C(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C14H18INO3/c1-3-4-8-16(9-10(2)15)14(19)11-6-5-7-12(17)13(11)18/h5-7,17-18H,2-4,8-9H2,1H3 |
| InChIKey | AVXMUBAVONSTGB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|