C13H18N2O4 — CID 114344176
N-(2-amino-2-oxoethyl)-N-butyl-2,3-dihydroxybenzamide (PubChem CID 114344176) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N-butyl-2,3-dihydroxybenzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-N-butyl-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114344176 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N-butyl-2,3-dihydroxybenzamide |
| SMILES | CCCCN(CC(N)=O)C(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C13H18N2O4/c1-2-3-7-15(8-11(14)17)13(19)9-5-4-6-10(16)12(9)18/h4-6,16,18H,2-3,7-8H2,1H3,(H2,14,17) |
| InChIKey | ZOJFRYXIPSNRHD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|