C11H14ClNOS — CID 10435549
3-chloro-2-ethylsulfanyl-N,N-dimethylbenzamide (PubChem CID 10435549) has the molecular formula C11H14ClNOS and a molecular weight of 243.76 g/mol. Its IUPAC name is 3-chloro-2-ethylsulfanyl-N,N-dimethylbenzamide.
| Compound Name | 3-chloro-2-ethylsulfanyl-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 10435549 |
| Molecular Formula | C11H14ClNOS |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 3-chloro-2-ethylsulfanyl-N,N-dimethylbenzamide |
| SMILES | CCSc1c(Cl)cccc1C(=O)N(C)C |
| InChI | InChI=1S/C11H14ClNOS/c1-4-15-10-8(11(14)13(2)3)6-5-7-9(10)12/h5-7H,4H2,1-3H3 |
| InChIKey | UDUZNTSIQOZGMY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |