C18H18Cl2N2O2 — CID 131902894
3-[[2-(2,6-dichlorophenyl)acetyl]amino]-N,N,2-trimethylbenzamide (PubChem CID 131902894) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is 3-[[2-(2,6-dichlorophenyl)acetyl]amino]-N,N,2-trimethylbenzamide.
| Compound Name | 3-[[2-(2,6-dichlorophenyl)acetyl]amino]-N,N,2-trimethylbenzamide |
|---|---|
| PubChem CID | 131902894 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 3-[[2-(2,6-dichlorophenyl)acetyl]amino]-N,N,2-trimethylbenzamide |
| SMILES | Cc1c(NC(=O)Cc2c(Cl)cccc2Cl)cccc1C(=O)N(C)C |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-11-12(18(24)22(2)3)6-4-9-16(11)21-17(23)10-13-14(19)7-5-8-15(13)20/h4-9H,10H2,1-3H3,(H,21,23) |
| InChIKey | UTAVUESRAYECOZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |