C13H21BrN2O2 — CID 104652711
2-[1-(5-bromofuran-2-yl)ethylamino]-N,4-dimethylpentanamide (PubChem CID 104652711) has the molecular formula C13H21BrN2O2 and a molecular weight of 317.23 g/mol. Its IUPAC name is 2-[1-(5-bromofuran-2-yl)ethylamino]-N,4-dimethylpentanamide.
| Compound Name | 2-[1-(5-bromofuran-2-yl)ethylamino]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 104652711 |
| Molecular Formula | C13H21BrN2O2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 2-[1-(5-bromofuran-2-yl)ethylamino]-N,4-dimethylpentanamide |
| SMILES | CNC(=O)C(CC(C)C)NC(C)c1ccc(Br)o1 |
| InChI | InChI=1S/C13H21BrN2O2/c1-8(2)7-10(13(17)15-4)16-9(3)11-5-6-12(14)18-11/h5-6,8-10,16H,7H2,1-4H3,(H,15,17) |
| InChIKey | HTHBKPKQBLZXHJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |