C14H23NO3 — CID 43689060
methyl 4-methyl-2-[1-(5-methylfuran-2-yl)ethylamino]pentanoate (PubChem CID 43689060) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is methyl 4-methyl-2-[1-(5-methylfuran-2-yl)ethylamino]pentanoate.
| Compound Name | methyl 4-methyl-2-[1-(5-methylfuran-2-yl)ethylamino]pentanoate |
|---|---|
| PubChem CID | 43689060 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | methyl 4-methyl-2-[1-(5-methylfuran-2-yl)ethylamino]pentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(C)c1ccc(C)o1 |
| InChI | InChI=1S/C14H23NO3/c1-9(2)8-12(14(16)17-5)15-11(4)13-7-6-10(3)18-13/h6-7,9,11-12,15H,8H2,1-5H3 |
| InChIKey | XYENUOAWPMMPFG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |