C16H25NO3 — CID 43689061
methyl 2-[1-(3-methoxyphenyl)ethylamino]-4-methylpentanoate (PubChem CID 43689061) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is methyl 2-[1-(3-methoxyphenyl)ethylamino]-4-methylpentanoate.
| Compound Name | methyl 2-[1-(3-methoxyphenyl)ethylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 43689061 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | methyl 2-[1-(3-methoxyphenyl)ethylamino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(C)c1cccc(OC)c1 |
| InChI | InChI=1S/C16H25NO3/c1-11(2)9-15(16(18)20-5)17-12(3)13-7-6-8-14(10-13)19-4/h6-8,10-12,15,17H,9H2,1-5H3 |
| InChIKey | VYVZGHGTQZUFJT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |