C13H21BrN2O2 — CID 104652645
2-[1-(5-bromofuran-2-yl)ethylamino]-N,N-diethylpropanamide (PubChem CID 104652645) has the molecular formula C13H21BrN2O2 and a molecular weight of 317.23 g/mol. Its IUPAC name is 2-[1-(5-bromofuran-2-yl)ethylamino]-N,N-diethylpropanamide.
| Compound Name | 2-[1-(5-bromofuran-2-yl)ethylamino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 104652645 |
| Molecular Formula | C13H21BrN2O2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 2-[1-(5-bromofuran-2-yl)ethylamino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)NC(C)c1ccc(Br)o1 |
| InChI | InChI=1S/C13H21BrN2O2/c1-5-16(6-2)13(17)10(4)15-9(3)11-7-8-12(14)18-11/h7-10,15H,5-6H2,1-4H3 |
| InChIKey | PQBJANNKGDQWKS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |