C11H17BrN2O2 — CID 107094033
2-[1-(5-bromofuran-2-yl)ethylamino]-N-ethyl-N-methylacetamide (PubChem CID 107094033) has the molecular formula C11H17BrN2O2 and a molecular weight of 289.17 g/mol. Its IUPAC name is 2-[1-(5-bromofuran-2-yl)ethylamino]-N-ethyl-N-methylacetamide.
| Compound Name | 2-[1-(5-bromofuran-2-yl)ethylamino]-N-ethyl-N-methylacetamide |
|---|---|
| PubChem CID | 107094033 |
| Molecular Formula | C11H17BrN2O2 |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2-[1-(5-bromofuran-2-yl)ethylamino]-N-ethyl-N-methylacetamide |
| SMILES | CCN(C)C(=O)CNC(C)c1ccc(Br)o1 |
| InChI | InChI=1S/C11H17BrN2O2/c1-4-14(3)11(15)7-13-8(2)9-5-6-10(12)16-9/h5-6,8,13H,4,7H2,1-3H3 |
| InChIKey | MEEXZPJSCCRYBW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |