C9H13BrN2O2 — CID 108872969
3-(5-bromofuran-2-yl)-1,1-diethylurea (PubChem CID 108872969) has the molecular formula C9H13BrN2O2 and a molecular weight of 261.12 g/mol. Its IUPAC name is 3-(5-bromofuran-2-yl)-1,1-diethylurea.
| Compound Name | 3-(5-bromofuran-2-yl)-1,1-diethylurea |
|---|---|
| PubChem CID | 108872969 |
| Molecular Formula | C9H13BrN2O2 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 3-(5-bromofuran-2-yl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1ccc(Br)o1 |
| InChI | InChI=1S/C9H13BrN2O2/c1-3-12(4-2)9(13)11-8-6-5-7(10)14-8/h5-6H,3-4H2,1-2H3,(H,11,13) |
| InChIKey | RCTFWYJYXHCNDT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |