C11H14BrNO2 — CID 76872023
3-(5-bromofuran-2-yl)-N,N-diethylprop-2-enamide (PubChem CID 76872023) has the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. Its IUPAC name is 3-(5-bromofuran-2-yl)-N,N-diethylprop-2-enamide.
| Compound Name | 3-(5-bromofuran-2-yl)-N,N-diethylprop-2-enamide |
|---|---|
| PubChem CID | 76872023 |
| Molecular Formula | C11H14BrNO2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 3-(5-bromofuran-2-yl)-N,N-diethylprop-2-enamide |
| SMILES | CCN(CC)C(=O)C=Cc1ccc(Br)o1 |
| InChI | InChI=1S/C11H14BrNO2/c1-3-13(4-2)11(14)8-6-9-5-7-10(12)15-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | JBTRXYKXJMBOIZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|