C13H16BrNO4 — CID 60830109
2-[[(E)-3-(5-bromofuran-2-yl)prop-2-enoyl]-butan-2-ylamino]acetic acid (PubChem CID 60830109) has the molecular formula C13H16BrNO4 and a molecular weight of 330.18 g/mol. Its IUPAC name is 2-[[(E)-3-(5-bromofuran-2-yl)prop-2-enoyl]-butan-2-ylamino]acetic acid.
| Compound Name | 2-[[(E)-3-(5-bromofuran-2-yl)prop-2-enoyl]-butan-2-ylamino]acetic acid |
|---|---|
| PubChem CID | 60830109 |
| Molecular Formula | C13H16BrNO4 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 2-[[(E)-3-(5-bromofuran-2-yl)prop-2-enoyl]-butan-2-ylamino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)C(=O)/C=C/c1ccc(Br)o1 |
| InChI | InChI=1S/C13H16BrNO4/c1-3-9(2)15(8-13(17)18)12(16)7-5-10-4-6-11(14)19-10/h4-7,9H,3,8H2,1-2H3,(H,17,18)/b7-5+ |
| InChIKey | QGTFSBXYVJIIMR-FNORWQNLSA-N |
| XLogP | 2.77 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|