C9H12BrN3O3 — CID 108873033
N-[2-[(5-bromofuran-2-yl)carbamoylamino]ethyl]acetamide (PubChem CID 108873033) has the molecular formula C9H12BrN3O3 and a molecular weight of 290.12 g/mol. Its IUPAC name is N-[2-[(5-bromofuran-2-yl)carbamoylamino]ethyl]acetamide.
| Compound Name | N-[2-[(5-bromofuran-2-yl)carbamoylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 108873033 |
| Molecular Formula | C9H12BrN3O3 |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | N-[2-[(5-bromofuran-2-yl)carbamoylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNC(=O)Nc1ccc(Br)o1 |
| InChI | InChI=1S/C9H12BrN3O3/c1-6(14)11-4-5-12-9(15)13-8-3-2-7(10)16-8/h2-3H,4-5H2,1H3,(H,11,14)(H2,12,13,15) |
| InChIKey | PWDYFHWAERFGNA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|