C12H14BrN3O3 — CID 47226214
N-(2-acetamidoethyl)-N'-(4-bromophenyl)oxamide (PubChem CID 47226214) has the molecular formula C12H14BrN3O3 and a molecular weight of 328.17 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-N'-(4-bromophenyl)oxamide.
| Compound Name | N-(2-acetamidoethyl)-N'-(4-bromophenyl)oxamide |
|---|---|
| PubChem CID | 47226214 |
| Molecular Formula | C12H14BrN3O3 |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | N-(2-acetamidoethyl)-N'-(4-bromophenyl)oxamide |
| SMILES | CC(=O)NCCNC(=O)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H14BrN3O3/c1-8(17)14-6-7-15-11(18)12(19)16-10-4-2-9(13)3-5-10/h2-5H,6-7H2,1H3,(H,14,17)(H,15,18)(H,16,19) |
| InChIKey | AUFGLJHHSZEBAP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|