C12H12Cl2FN3O3 — CID 167889327
N-(2-acetamidoethyl)-N'-(3,5-dichloro-4-fluorophenyl)oxamide (PubChem CID 167889327) has the molecular formula C12H12Cl2FN3O3 and a molecular weight of 336.15 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-N'-(3,5-dichloro-4-fluorophenyl)oxamide.
| Compound Name | N-(2-acetamidoethyl)-N'-(3,5-dichloro-4-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 167889327 |
| Molecular Formula | C12H12Cl2FN3O3 |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | N-(2-acetamidoethyl)-N'-(3,5-dichloro-4-fluorophenyl)oxamide |
| SMILES | CC(=O)NCCNC(=O)C(=O)Nc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2FN3O3/c1-6(19)16-2-3-17-11(20)12(21)18-7-4-8(13)10(15)9(14)5-7/h4-5H,2-3H2,1H3,(H,16,19)(H,17,20)(H,18,21) |
| InChIKey | GEDRNJHVJGLJBA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|