C8H6Cl2INO — CID 156599788
N-(3,5-dichloro-4-iodophenyl)acetamide (PubChem CID 156599788) has the molecular formula C8H6Cl2INO and a molecular weight of 329.95 g/mol. Its IUPAC name is N-(3,5-dichloro-4-iodophenyl)acetamide.
| Compound Name | N-(3,5-dichloro-4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 156599788 |
| Molecular Formula | C8H6Cl2INO |
| Molecular Weight | 329.95 g/mol |
| Exact Mass | 328.89 |
| IUPAC Name | N-(3,5-dichloro-4-iodophenyl)acetamide |
| SMILES | CC(=O)Nc1cc(Cl)c(I)c(Cl)c1 |
| InChI | InChI=1S/C8H6Cl2INO/c1-4(13)12-5-2-6(9)8(11)7(10)3-5/h2-3H,1H3,(H,12,13) |
| InChIKey | QRSKIQFTCZAYMS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.95 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|