C9H6Cl2N2O — CID 134176863
N-(3,5-dichloro-4-cyanophenyl)acetamide (PubChem CID 134176863) has the molecular formula C9H6Cl2N2O and a molecular weight of 229.07 g/mol. Its IUPAC name is N-(3,5-dichloro-4-cyanophenyl)acetamide.
| Compound Name | N-(3,5-dichloro-4-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 134176863 |
| Molecular Formula | C9H6Cl2N2O |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | N-(3,5-dichloro-4-cyanophenyl)acetamide |
| SMILES | CC(=O)Nc1cc(Cl)c(C#N)c(Cl)c1 |
| InChI | InChI=1S/C9H6Cl2N2O/c1-5(14)13-6-2-8(10)7(4-12)9(11)3-6/h2-3H,1H3,(H,13,14) |
| InChIKey | OABZMIRJEYDEFS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |