C10H7N3OS — CID 45077726
N-(2-cyano-1,3-benzothiazol-6-yl)acetamide (PubChem CID 45077726) has the molecular formula C10H7N3OS and a molecular weight of 217.25 g/mol. Its IUPAC name is N-(2-cyano-1,3-benzothiazol-6-yl)acetamide.
| Compound Name | N-(2-cyano-1,3-benzothiazol-6-yl)acetamide |
|---|---|
| PubChem CID | 45077726 |
| Molecular Formula | C10H7N3OS |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | N-(2-cyano-1,3-benzothiazol-6-yl)acetamide |
| SMILES | CC(=O)Nc1ccc2nc(C#N)sc2c1 |
| InChI | InChI=1S/C10H7N3OS/c1-6(14)12-7-2-3-8-9(4-7)15-10(5-11)13-8/h2-4H,1H3,(H,12,14) |
| InChIKey | JSHKOWBTIQMRTC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |