C14H14N2OS — CID 130283691
N-(2-ethynyl-1,3-benzothiazol-6-yl)-3-methylbutanamide (PubChem CID 130283691) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is N-(2-ethynyl-1,3-benzothiazol-6-yl)-3-methylbutanamide.
| Compound Name | N-(2-ethynyl-1,3-benzothiazol-6-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 130283691 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | N-(2-ethynyl-1,3-benzothiazol-6-yl)-3-methylbutanamide |
| SMILES | C#Cc1nc2ccc(NC(=O)CC(C)C)cc2s1 |
| InChI | InChI=1S/C14H14N2OS/c1-4-14-16-11-6-5-10(8-12(11)18-14)15-13(17)7-9(2)3/h1,5-6,8-9H,7H2,2-3H3,(H,15,17) |
| InChIKey | KHNJALKHGDKZSW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|