C11H13Cl2FN2O — CID 107574504
3-amino-N-(3,5-dichloro-4-fluorophenyl)-2,2-dimethylpropanamide (PubChem CID 107574504) has the molecular formula C11H13Cl2FN2O and a molecular weight of 279.14 g/mol. Its IUPAC name is 3-amino-N-(3,5-dichloro-4-fluorophenyl)-2,2-dimethylpropanamide.
| Compound Name | 3-amino-N-(3,5-dichloro-4-fluorophenyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 107574504 |
| Molecular Formula | C11H13Cl2FN2O |
| Molecular Weight | 279.14 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 3-amino-N-(3,5-dichloro-4-fluorophenyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(CN)C(=O)Nc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2FN2O/c1-11(2,5-15)10(17)16-6-3-7(12)9(14)8(13)4-6/h3-4H,5,15H2,1-2H3,(H,16,17) |
| InChIKey | MPBVKZNBURAJGN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.14 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|