C8H7Cl2FN2O — CID 107573760
2-(3,5-dichloro-4-fluoroanilino)acetamide (PubChem CID 107573760) has the molecular formula C8H7Cl2FN2O and a molecular weight of 237.06 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-fluoroanilino)acetamide.
| Compound Name | 2-(3,5-dichloro-4-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 107573760 |
| Molecular Formula | C8H7Cl2FN2O |
| Molecular Weight | 237.06 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | 2-(3,5-dichloro-4-fluoroanilino)acetamide |
| SMILES | NC(=O)CNc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C8H7Cl2FN2O/c9-5-1-4(13-3-7(12)14)2-6(10)8(5)11/h1-2,13H,3H2,(H2,12,14) |
| InChIKey | UKBWNEAYLHRUER-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.06 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|