C11H13Cl2FN2O — CID 107574395
2-(aminomethyl)-N-(3,5-dichloro-4-fluorophenyl)butanamide (PubChem CID 107574395) has the molecular formula C11H13Cl2FN2O and a molecular weight of 279.14 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(3,5-dichloro-4-fluorophenyl)butanamide.
| Compound Name | 2-(aminomethyl)-N-(3,5-dichloro-4-fluorophenyl)butanamide |
|---|---|
| PubChem CID | 107574395 |
| Molecular Formula | C11H13Cl2FN2O |
| Molecular Weight | 279.14 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2-(aminomethyl)-N-(3,5-dichloro-4-fluorophenyl)butanamide |
| SMILES | CCC(CN)C(=O)Nc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2FN2O/c1-2-6(5-15)11(17)16-7-3-8(12)10(14)9(13)4-7/h3-4,6H,2,5,15H2,1H3,(H,16,17) |
| InChIKey | BGJIATPYEXGAFV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.14 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|