C11H15IN2O — CID 65225745
2-(aminomethyl)-N-(4-iodophenyl)butanamide (PubChem CID 65225745) has the molecular formula C11H15IN2O and a molecular weight of 318.16 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(4-iodophenyl)butanamide.
| Compound Name | 2-(aminomethyl)-N-(4-iodophenyl)butanamide |
|---|---|
| PubChem CID | 65225745 |
| Molecular Formula | C11H15IN2O |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 2-(aminomethyl)-N-(4-iodophenyl)butanamide |
| SMILES | CCC(CN)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C11H15IN2O/c1-2-8(7-13)11(15)14-10-5-3-9(12)4-6-10/h3-6,8H,2,7,13H2,1H3,(H,14,15) |
| InChIKey | CSVJOVPJGQBJBJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|