About 2-(aminomethyl)-N-[4-(1,3-dioxolan-2-yl)phenyl]butanamide
2-(aminomethyl)-N-[4-(1,3-dioxolan-2-yl)phenyl]butanamide (PubChem CID 106911773) has the molecular formula C14H20N2O3
and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[4-(1,3-dioxolan-2-yl)phenyl]butanamide.
Molecular Properties
| Compound Name | 2-(aminomethyl)-N-[4-(1,3-dioxolan-2-yl)phenyl]butanamide |
| PubChem CID | 106911773 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-(aminomethyl)-N-[4-(1,3-dioxolan-2-yl)phenyl]butanamide |
| SMILES | CCC(CN)C(=O)Nc1ccc(C2OCCO2)cc1 |
| InChI | InChI=1S/C14H20N2O3/c1-2-10(9-15)13(17)16-12-5-3-11(4-6-12)14-18-7-8-19-14/h3-6,10,14H,2,7-9,15H2,1H3,(H,16,17) |
| InChIKey | GUGGPKOKXRGNEQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(aminomethyl)-N-[4-(1,3-dioxolan-2-yl)phenyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-N-[4-(1,3-dioxolan-2-yl)phenyl]butanamide?
The IUPAC name of 2-(aminomethyl)-N-[4-(1,3-dioxolan-2-yl)phenyl]butanamide (CID 106911773) is 2-(aminomethyl)-N-[4-(1,3-dioxolan-2-yl)phenyl]butanamide.
What is the SMILES notation for 2-(aminomethyl)-N-[4-(1,3-dioxolan-2-yl)phenyl]butanamide?
The canonical SMILES for 2-(aminomethyl)-N-[4-(1,3-dioxolan-2-yl)phenyl]butanamide is CCC(CN)C(=O)Nc1ccc(C2OCCO2)cc1.
What is the InChIKey of 2-(aminomethyl)-N-[4-(1,3-dioxolan-2-yl)phenyl]butanamide?
The InChIKey is GUGGPKOKXRGNEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3/c1-2-10(9-15)13(17)16-12-5-3-11(4-6-12)14-18-7-8-19-14/h3-6,10,14H,2,7-9,15H2,1H3,(H,16,17).
What are the key properties of 2-(aminomethyl)-N-[4-(1,3-dioxolan-2-yl)phenyl]butanamide?
2-(aminomethyl)-N-[4-(1,3-dioxolan-2-yl)phenyl]butanamide has a molecular weight of 264.32 g/mol, XLogP of 1.66, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-N-[4-(1,3-dioxolan-2-yl)phenyl]butanamide is sourced from PubChem (CID 106911773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).