C14H19NO3 — CID 110732799
N-[4-(1,3-dioxolan-2-yl)phenyl]-2,2-dimethylpropanamide (PubChem CID 110732799) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is N-[4-(1,3-dioxolan-2-yl)phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-(1,3-dioxolan-2-yl)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 110732799 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-[4-(1,3-dioxolan-2-yl)phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(C2OCCO2)cc1 |
| InChI | InChI=1S/C14H19NO3/c1-14(2,3)13(16)15-11-6-4-10(5-7-11)12-17-8-9-18-12/h4-7,12H,8-9H2,1-3H3,(H,15,16) |
| InChIKey | GGTOIZHCPJIZQI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |