C15H22F2N2O — CID 43739406
2-[1-(2,6-difluorophenyl)ethylamino]-N,N-diethylpropanamide (PubChem CID 43739406) has the molecular formula C15H22F2N2O and a molecular weight of 284.35 g/mol. Its IUPAC name is 2-[1-(2,6-difluorophenyl)ethylamino]-N,N-diethylpropanamide.
| Compound Name | 2-[1-(2,6-difluorophenyl)ethylamino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 43739406 |
| Molecular Formula | C15H22F2N2O |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-[1-(2,6-difluorophenyl)ethylamino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)NC(C)c1c(F)cccc1F |
| InChI | InChI=1S/C15H22F2N2O/c1-5-19(6-2)15(20)11(4)18-10(3)14-12(16)8-7-9-13(14)17/h7-11,18H,5-6H2,1-4H3 |
| InChIKey | WWKYDBSFKYAAKO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |