C14H24N2OS — CID 81409142
N-(3-methylbutyl)-2-[[(1S)-1-thiophen-2-ylethyl]amino]propanamide (PubChem CID 81409142) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-[[(1S)-1-thiophen-2-ylethyl]amino]propanamide.
| Compound Name | N-(3-methylbutyl)-2-[[(1S)-1-thiophen-2-ylethyl]amino]propanamide |
|---|---|
| PubChem CID | 81409142 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | N-(3-methylbutyl)-2-[[(1S)-1-thiophen-2-ylethyl]amino]propanamide |
| SMILES | CC(C)CCNC(=O)C(C)N[C@@H](C)c1cccs1 |
| InChI | InChI=1S/C14H24N2OS/c1-10(2)7-8-15-14(17)12(4)16-11(3)13-6-5-9-18-13/h5-6,9-12,16H,7-8H2,1-4H3,(H,15,17)/t11-,12?/m0/s1 |
| InChIKey | YVILTSKOMVRTLD-PXYINDEMSA-N |
| XLogP | 2.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |