C26H29N3O4S — CID 87345171
(2S)-N-(cyanomethyl)-2-[[(S)-furan-2-yl-[4-(4-methylsulfonylphenyl)phenyl]methyl]amino]-4-methylpentanamide (PubChem CID 87345171) has the molecular formula C26H29N3O4S and a molecular weight of 479.60 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-2-[[(S)-furan-2-yl-[4-(4-methylsulfonylphenyl)phenyl]methyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-N-(cyanomethyl)-2-[[(S)-furan-2-yl-[4-(4-methylsulfonylphenyl)phenyl]methyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 87345171 |
| Molecular Formula | C26H29N3O4S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | (2S)-N-(cyanomethyl)-2-[[(S)-furan-2-yl-[4-(4-methylsulfonylphenyl)phenyl]methyl]amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N[C@@H](c1ccc(-c2ccc(S(C)(=O)=O)cc2)cc1)c1ccco1)C(=O)NCC#N |
| InChI | InChI=1S/C26H29N3O4S/c1-18(2)17-23(26(30)28-15-14-27)29-25(24-5-4-16-33-24)21-8-6-19(7-9-21)20-10-12-22(13-11-20)34(3,31)32/h4-13,16,18,23,25,29H,15,17H2,1-3H3,(H,28,30)/t23-,25-/m0/s1 |
| InChIKey | PLEHXWXPNYXHRZ-ZCYQVOJMSA-N |
| XLogP | 4.08 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|