C21H22BrClN2O2 — CID 10026746
(2S)-2-[(R)-(4-bromophenyl)-(4-chlorophenyl)methoxy]-N-(cyanomethyl)-4-methylpentanamide (PubChem CID 10026746) has the molecular formula C21H22BrClN2O2 and a molecular weight of 449.78 g/mol. Its IUPAC name is (2S)-2-[(R)-(4-bromophenyl)-(4-chlorophenyl)methoxy]-N-(cyanomethyl)-4-methylpentanamide.
| Compound Name | (2S)-2-[(R)-(4-bromophenyl)-(4-chlorophenyl)methoxy]-N-(cyanomethyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 10026746 |
| Molecular Formula | C21H22BrClN2O2 |
| Molecular Weight | 449.78 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | (2S)-2-[(R)-(4-bromophenyl)-(4-chlorophenyl)methoxy]-N-(cyanomethyl)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](O[C@H](c1ccc(Cl)cc1)c1ccc(Br)cc1)C(=O)NCC#N |
| InChI | InChI=1S/C21H22BrClN2O2/c1-14(2)13-19(21(26)25-12-11-24)27-20(15-3-7-17(22)8-4-15)16-5-9-18(23)10-6-16/h3-10,14,19-20H,12-13H2,1-2H3,(H,25,26)/t19-,20-/m0/s1 |
| InChIKey | AVAXBDXFFWCHPY-PMACEKPBSA-N |
| XLogP | 5.26 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.78 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|