C27H35N3O3 — CID 90947766
(2S)-N-(cyanomethyl)-2-[[4-[(2R)-2-hydroxy-1-methylpiperidin-4-yl]phenyl]-phenylmethoxy]-4-methylpentanamide (PubChem CID 90947766) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-2-[[4-[(2R)-2-hydroxy-1-methylpiperidin-4-yl]phenyl]-phenylmethoxy]-4-methylpentanamide.
| Compound Name | (2S)-N-(cyanomethyl)-2-[[4-[(2R)-2-hydroxy-1-methylpiperidin-4-yl]phenyl]-phenylmethoxy]-4-methylpentanamide |
|---|---|
| PubChem CID | 90947766 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | (2S)-N-(cyanomethyl)-2-[[4-[(2R)-2-hydroxy-1-methylpiperidin-4-yl]phenyl]-phenylmethoxy]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](OC(c1ccccc1)c1ccc(C2CCN(C)[C@H](O)C2)cc1)C(=O)NCC#N |
| InChI | InChI=1S/C27H35N3O3/c1-19(2)17-24(27(32)29-15-14-28)33-26(21-7-5-4-6-8-21)22-11-9-20(10-12-22)23-13-16-30(3)25(31)18-23/h4-12,19,23-26,31H,13,15-18H2,1-3H3,(H,29,32)/t23?,24-,25+,26?/m0/s1 |
| InChIKey | JQCCEDIINBNNRU-OONXHFSZSA-N |
| XLogP | 3.97 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|