C26H35NO3 — CID 91382709
methyl (2S)-4-methyl-2-[(R)-[4-(1-methylpiperidin-4-yl)phenyl]-phenylmethoxy]pentanoate (PubChem CID 91382709) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is methyl (2S)-4-methyl-2-[(R)-[4-(1-methylpiperidin-4-yl)phenyl]-phenylmethoxy]pentanoate.
| Compound Name | methyl (2S)-4-methyl-2-[(R)-[4-(1-methylpiperidin-4-yl)phenyl]-phenylmethoxy]pentanoate |
|---|---|
| PubChem CID | 91382709 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | methyl (2S)-4-methyl-2-[(R)-[4-(1-methylpiperidin-4-yl)phenyl]-phenylmethoxy]pentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)O[C@H](c1ccccc1)c1ccc(C2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C26H35NO3/c1-19(2)18-24(26(28)29-4)30-25(22-8-6-5-7-9-22)23-12-10-20(11-13-23)21-14-16-27(3)17-15-21/h5-13,19,21,24-25H,14-18H2,1-4H3/t24-,25+/m0/s1 |
| InChIKey | IMNCVLZNASQMRJ-LOSJGSFVSA-N |
| XLogP | 5.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |