C32H38N4O2 — CID 10459023
(2S)-N-(cyanomethyl)-4-methyl-2-[(R)-[4-[4-(4-methylpiperazin-1-yl)phenyl]phenyl]-phenylmethoxy]pentanamide (PubChem CID 10459023) has the molecular formula C32H38N4O2 and a molecular weight of 510.68 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-4-methyl-2-[(R)-[4-[4-(4-methylpiperazin-1-yl)phenyl]phenyl]-phenylmethoxy]pentanamide.
| Compound Name | (2S)-N-(cyanomethyl)-4-methyl-2-[(R)-[4-[4-(4-methylpiperazin-1-yl)phenyl]phenyl]-phenylmethoxy]pentanamide |
|---|---|
| PubChem CID | 10459023 |
| Molecular Formula | C32H38N4O2 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | (2S)-N-(cyanomethyl)-4-methyl-2-[(R)-[4-[4-(4-methylpiperazin-1-yl)phenyl]phenyl]-phenylmethoxy]pentanamide |
| SMILES | CC(C)C[C@H](O[C@H](c1ccccc1)c1ccc(-c2ccc(N3CCN(C)CC3)cc2)cc1)C(=O)NCC#N |
| InChI | InChI=1S/C32H38N4O2/c1-24(2)23-30(32(37)34-18-17-33)38-31(27-7-5-4-6-8-27)28-11-9-25(10-12-28)26-13-15-29(16-14-26)36-21-19-35(3)20-22-36/h4-16,24,30-31H,18-23H2,1-3H3,(H,34,37)/t30-,31+/m0/s1 |
| InChIKey | LPXLTSRBZBLIGK-IOWSJCHKSA-N |
| XLogP | 5.27 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|