C27H27N3O4 — CID 10049763
2-[4-[[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]oxy-phenylmethyl]phenyl]pyridine-4-carboxylic acid (PubChem CID 10049763) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 2-[4-[[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]oxy-phenylmethyl]phenyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[4-[[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]oxy-phenylmethyl]phenyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 10049763 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 2-[4-[[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]oxy-phenylmethyl]phenyl]pyridine-4-carboxylic acid |
| SMILES | CC(C)C[C@H](OC(c1ccccc1)c1ccc(-c2cc(C(=O)O)ccn2)cc1)C(=O)NCC#N |
| InChI | InChI=1S/C27H27N3O4/c1-18(2)16-24(26(31)30-15-13-28)34-25(20-6-4-3-5-7-20)21-10-8-19(9-11-21)23-17-22(27(32)33)12-14-29-23/h3-12,14,17-18,24-25H,15-16H2,1-2H3,(H,30,31)(H,32,33)/t24-,25?/m0/s1 |
| InChIKey | IBHHNWJBBVTOIA-SKCDSABHSA-N |
| XLogP | 4.61 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|