C27H30IN3O2 — CID 87847165
(2S)-N-(cyanomethyl)-4-methyl-2-[[4-(1-methylpyridin-1-ium-3-yl)phenyl]-phenylmethoxy]pentanamide iodide (PubChem CID 87847165) has the molecular formula C27H30IN3O2 and a molecular weight of 555.46 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-4-methyl-2-[[4-(1-methylpyridin-1-ium-3-yl)phenyl]-phenylmethoxy]pentanamide iodide.
| Compound Name | (2S)-N-(cyanomethyl)-4-methyl-2-[[4-(1-methylpyridin-1-ium-3-yl)phenyl]-phenylmethoxy]pentanamide iodide |
|---|---|
| PubChem CID | 87847165 |
| Molecular Formula | C27H30IN3O2 |
| Molecular Weight | 555.46 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | (2S)-N-(cyanomethyl)-4-methyl-2-[[4-(1-methylpyridin-1-ium-3-yl)phenyl]-phenylmethoxy]pentanamide iodide |
| SMILES | CC(C)C[C@H](OC(c1ccccc1)c1ccc(-c2ccc[n+](C)c2)cc1)C(=O)NCC#N.[I-] |
| InChI | InChI=1S/C27H29N3O2.HI/c1-20(2)18-25(27(31)29-16-15-28)32-26(22-8-5-4-6-9-22)23-13-11-21(12-14-23)24-10-7-17-30(3)19-24;/h4-14,17,19-20,25-26H,16,18H2,1-3H3;1H/t25-,26?;/m0./s1 |
| InChIKey | HUWGRWRNMOLKFI-XZTCEYQHSA-N |
| XLogP | 1.34 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|