C26H30NO3+ — CID 69476349
methyl (2S)-4-methyl-2-[[4-(1-methylpyridin-1-ium-4-yl)phenyl]-phenylmethoxy]pentanoate (PubChem CID 69476349) has the molecular formula C26H30NO3+ and a molecular weight of 404.53 g/mol. Its IUPAC name is methyl (2S)-4-methyl-2-[[4-(1-methylpyridin-1-ium-4-yl)phenyl]-phenylmethoxy]pentanoate.
| Compound Name | methyl (2S)-4-methyl-2-[[4-(1-methylpyridin-1-ium-4-yl)phenyl]-phenylmethoxy]pentanoate |
|---|---|
| PubChem CID | 69476349 |
| Molecular Formula | C26H30NO3+ |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | methyl (2S)-4-methyl-2-[[4-(1-methylpyridin-1-ium-4-yl)phenyl]-phenylmethoxy]pentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)OC(c1ccccc1)c1ccc(-c2cc[n+](C)cc2)cc1 |
| InChI | InChI=1S/C26H30NO3/c1-19(2)18-24(26(28)29-4)30-25(22-8-6-5-7-9-22)23-12-10-20(11-13-23)21-14-16-27(3)17-15-21/h5-17,19,24-25H,18H2,1-4H3/q+1/t24-,25?/m0/s1 |
| InChIKey | OUQIMOHZXLFSNP-SKCDSABHSA-N |
| XLogP | 4.87 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|