C26H30INO3 — CID 69473250
methyl (2S)-4-methyl-2-[[4-(1-methylpyridin-1-ium-3-yl)phenyl]-phenylmethoxy]pentanoate iodide (PubChem CID 69473250) has the molecular formula C26H30INO3 and a molecular weight of 531.43 g/mol. Its IUPAC name is methyl (2S)-4-methyl-2-[[4-(1-methylpyridin-1-ium-3-yl)phenyl]-phenylmethoxy]pentanoate iodide.
| Compound Name | methyl (2S)-4-methyl-2-[[4-(1-methylpyridin-1-ium-3-yl)phenyl]-phenylmethoxy]pentanoate iodide |
|---|---|
| PubChem CID | 69473250 |
| Molecular Formula | C26H30INO3 |
| Molecular Weight | 531.43 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | methyl (2S)-4-methyl-2-[[4-(1-methylpyridin-1-ium-3-yl)phenyl]-phenylmethoxy]pentanoate iodide |
| SMILES | COC(=O)[C@H](CC(C)C)OC(c1ccccc1)c1ccc(-c2ccc[n+](C)c2)cc1.[I-] |
| InChI | InChI=1S/C26H30NO3.HI/c1-19(2)17-24(26(28)29-4)30-25(21-9-6-5-7-10-21)22-14-12-20(13-15-22)23-11-8-16-27(3)18-23;/h5-16,18-19,24-25H,17H2,1-4H3;1H/q+1;/p-1/t24-,25?;/m0./s1 |
| InChIKey | SRPHFEPKYIBBOD-PQHVFQCZSA-M |
| XLogP | 1.88 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|