C23H25F3N2O2S — CID 87951733
N-(cyanomethyl)-4-methyl-2-[(1R)-2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethoxy]pentanamide (PubChem CID 87951733) has the molecular formula C23H25F3N2O2S and a molecular weight of 450.53 g/mol. Its IUPAC name is N-(cyanomethyl)-4-methyl-2-[(1R)-2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethoxy]pentanamide.
| Compound Name | N-(cyanomethyl)-4-methyl-2-[(1R)-2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethoxy]pentanamide |
|---|---|
| PubChem CID | 87951733 |
| Molecular Formula | C23H25F3N2O2S |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | N-(cyanomethyl)-4-methyl-2-[(1R)-2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethoxy]pentanamide |
| SMILES | CSc1ccc(-c2ccc([C@@H](OC(CC(C)C)C(=O)NCC#N)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H25F3N2O2S/c1-15(2)14-20(22(29)28-13-12-27)30-21(23(24,25)26)18-6-4-16(5-7-18)17-8-10-19(31-3)11-9-17/h4-11,15,20-21H,13-14H2,1-3H3,(H,28,29)/t20?,21-/m1/s1 |
| InChIKey | NDFWNGBTLHEANF-BPGUCPLFSA-N |
| XLogP | 5.75 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|