C26H31F3N4O2 — CID 10028453
N-(cyanomethyl)-4-methyl-2-[2,2,2-trifluoro-1-[4-(4-piperazin-1-ylphenyl)phenyl]ethoxy]pentanamide (PubChem CID 10028453) has the molecular formula C26H31F3N4O2 and a molecular weight of 488.55 g/mol. Its IUPAC name is N-(cyanomethyl)-4-methyl-2-[2,2,2-trifluoro-1-[4-(4-piperazin-1-ylphenyl)phenyl]ethoxy]pentanamide.
| Compound Name | N-(cyanomethyl)-4-methyl-2-[2,2,2-trifluoro-1-[4-(4-piperazin-1-ylphenyl)phenyl]ethoxy]pentanamide |
|---|---|
| PubChem CID | 10028453 |
| Molecular Formula | C26H31F3N4O2 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | N-(cyanomethyl)-4-methyl-2-[2,2,2-trifluoro-1-[4-(4-piperazin-1-ylphenyl)phenyl]ethoxy]pentanamide |
| SMILES | CC(C)CC(OC(c1ccc(-c2ccc(N3CCNCC3)cc2)cc1)C(F)(F)F)C(=O)NCC#N |
| InChI | InChI=1S/C26H31F3N4O2/c1-18(2)17-23(25(34)32-12-11-30)35-24(26(27,28)29)21-5-3-19(4-6-21)20-7-9-22(10-8-20)33-15-13-31-14-16-33/h3-10,18,23-24,31H,12-17H2,1-2H3,(H,32,34) |
| InChIKey | QKEDLIMBZMMPJK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|