C22H30N6OS — CID 87715825
(2S)-N-(cyanomethyl)-4-methyl-2-[[3-methyl-4-(4-piperazin-1-ylphenyl)-1,2-thiazol-5-yl]amino]pentanamide (PubChem CID 87715825) has the molecular formula C22H30N6OS and a molecular weight of 426.59 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-4-methyl-2-[[3-methyl-4-(4-piperazin-1-ylphenyl)-1,2-thiazol-5-yl]amino]pentanamide.
| Compound Name | (2S)-N-(cyanomethyl)-4-methyl-2-[[3-methyl-4-(4-piperazin-1-ylphenyl)-1,2-thiazol-5-yl]amino]pentanamide |
|---|---|
| PubChem CID | 87715825 |
| Molecular Formula | C22H30N6OS |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (2S)-N-(cyanomethyl)-4-methyl-2-[[3-methyl-4-(4-piperazin-1-ylphenyl)-1,2-thiazol-5-yl]amino]pentanamide |
| SMILES | Cc1nsc(N[C@@H](CC(C)C)C(=O)NCC#N)c1-c1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C22H30N6OS/c1-15(2)14-19(21(29)25-9-8-23)26-22-20(16(3)27-30-22)17-4-6-18(7-5-17)28-12-10-24-11-13-28/h4-7,15,19,24,26H,9-14H2,1-3H3,(H,25,29)/t19-/m0/s1 |
| InChIKey | SKLRXJIHVRCKSG-IBGZPJMESA-N |
| XLogP | 2.99 |
| TPSA | 93.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|