C21H28N6O2 — CID 22235795
N-(cyanomethyl)-4-methyl-2-[[3-(4-piperazin-1-ylphenyl)-1,2-oxazol-4-yl]amino]pentanamide (PubChem CID 22235795) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is N-(cyanomethyl)-4-methyl-2-[[3-(4-piperazin-1-ylphenyl)-1,2-oxazol-4-yl]amino]pentanamide.
| Compound Name | N-(cyanomethyl)-4-methyl-2-[[3-(4-piperazin-1-ylphenyl)-1,2-oxazol-4-yl]amino]pentanamide |
|---|---|
| PubChem CID | 22235795 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | N-(cyanomethyl)-4-methyl-2-[[3-(4-piperazin-1-ylphenyl)-1,2-oxazol-4-yl]amino]pentanamide |
| SMILES | CC(C)CC(Nc1conc1-c1ccc(N2CCNCC2)cc1)C(=O)NCC#N |
| InChI | InChI=1S/C21H28N6O2/c1-15(2)13-18(21(28)24-8-7-22)25-19-14-29-26-20(19)16-3-5-17(6-4-16)27-11-9-23-10-12-27/h3-6,14-15,18,23,25H,8-13H2,1-2H3,(H,24,28) |
| InChIKey | QJJOJGFYOYHRKE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|