C19H21N3O3S — CID 87715915
(2S)-2-[[4-(1,3-benzodioxol-5-yl)thiophen-3-yl]amino]-N-(cyanomethyl)-4-methylpentanamide (PubChem CID 87715915) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is (2S)-2-[[4-(1,3-benzodioxol-5-yl)thiophen-3-yl]amino]-N-(cyanomethyl)-4-methylpentanamide.
| Compound Name | (2S)-2-[[4-(1,3-benzodioxol-5-yl)thiophen-3-yl]amino]-N-(cyanomethyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 87715915 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (2S)-2-[[4-(1,3-benzodioxol-5-yl)thiophen-3-yl]amino]-N-(cyanomethyl)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](Nc1cscc1-c1ccc2c(c1)OCO2)C(=O)NCC#N |
| InChI | InChI=1S/C19H21N3O3S/c1-12(2)7-15(19(23)21-6-5-20)22-16-10-26-9-14(16)13-3-4-17-18(8-13)25-11-24-17/h3-4,8-10,12,15,22H,6-7,11H2,1-2H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | KLJLXYLRSQDJNA-HNNXBMFYSA-N |
| XLogP | 3.61 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|