C20H21N3OS2 — CID 87715881
(2S)-2-[[4-(1-benzothiophen-3-yl)thiophen-3-yl]amino]-N-(cyanomethyl)-4-methylpentanamide (PubChem CID 87715881) has the molecular formula C20H21N3OS2 and a molecular weight of 383.54 g/mol. Its IUPAC name is (2S)-2-[[4-(1-benzothiophen-3-yl)thiophen-3-yl]amino]-N-(cyanomethyl)-4-methylpentanamide.
| Compound Name | (2S)-2-[[4-(1-benzothiophen-3-yl)thiophen-3-yl]amino]-N-(cyanomethyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 87715881 |
| Molecular Formula | C20H21N3OS2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | (2S)-2-[[4-(1-benzothiophen-3-yl)thiophen-3-yl]amino]-N-(cyanomethyl)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](Nc1cscc1-c1csc2ccccc12)C(=O)NCC#N |
| InChI | InChI=1S/C20H21N3OS2/c1-13(2)9-17(20(24)22-8-7-21)23-18-12-25-10-16(18)15-11-26-19-6-4-3-5-14(15)19/h3-6,10-13,17,23H,8-9H2,1-2H3,(H,22,24)/t17-/m0/s1 |
| InChIKey | QPGFITHQOLICBS-KRWDZBQOSA-N |
| XLogP | 5.10 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|