C11H15BrN4OS — CID 86594562
(2S)-2-[(4-bromo-1,2-thiazol-5-yl)amino]-N-(cyanomethyl)-4-methylpentanamide (PubChem CID 86594562) has the molecular formula C11H15BrN4OS and a molecular weight of 331.24 g/mol. Its IUPAC name is (2S)-2-[(4-bromo-1,2-thiazol-5-yl)amino]-N-(cyanomethyl)-4-methylpentanamide.
| Compound Name | (2S)-2-[(4-bromo-1,2-thiazol-5-yl)amino]-N-(cyanomethyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 86594562 |
| Molecular Formula | C11H15BrN4OS |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | (2S)-2-[(4-bromo-1,2-thiazol-5-yl)amino]-N-(cyanomethyl)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](Nc1sncc1Br)C(=O)NCC#N |
| InChI | InChI=1S/C11H15BrN4OS/c1-7(2)5-9(10(17)14-4-3-13)16-11-8(12)6-15-18-11/h6-7,9,16H,4-5H2,1-2H3,(H,14,17)/t9-/m0/s1 |
| InChIKey | VILJFEIETMJXKK-VIFPVBQESA-N |
| XLogP | 2.37 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|