C20H25N3O3S — CID 87716000
(2S)-N-(cyanomethyl)-2-[[4-(2,5-dimethoxyphenyl)thiophen-3-yl]amino]-4-methylpentanamide (PubChem CID 87716000) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-2-[[4-(2,5-dimethoxyphenyl)thiophen-3-yl]amino]-4-methylpentanamide.
| Compound Name | (2S)-N-(cyanomethyl)-2-[[4-(2,5-dimethoxyphenyl)thiophen-3-yl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 87716000 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | (2S)-N-(cyanomethyl)-2-[[4-(2,5-dimethoxyphenyl)thiophen-3-yl]amino]-4-methylpentanamide |
| SMILES | COc1ccc(OC)c(-c2cscc2N[C@@H](CC(C)C)C(=O)NCC#N)c1 |
| InChI | InChI=1S/C20H25N3O3S/c1-13(2)9-17(20(24)22-8-7-21)23-18-12-27-11-16(18)15-10-14(25-3)5-6-19(15)26-4/h5-6,10-13,17,23H,8-9H2,1-4H3,(H,22,24)/t17-/m0/s1 |
| InChIKey | IFZGPBVEAXWZJM-KRWDZBQOSA-N |
| XLogP | 3.90 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|