C19H23N3O2S — CID 87715440
(2S)-N-(cyanomethyl)-2-[[4-[3-(hydroxymethyl)phenyl]thiophen-3-yl]amino]-4-methylpentanamide (PubChem CID 87715440) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-2-[[4-[3-(hydroxymethyl)phenyl]thiophen-3-yl]amino]-4-methylpentanamide.
| Compound Name | (2S)-N-(cyanomethyl)-2-[[4-[3-(hydroxymethyl)phenyl]thiophen-3-yl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 87715440 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (2S)-N-(cyanomethyl)-2-[[4-[3-(hydroxymethyl)phenyl]thiophen-3-yl]amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](Nc1cscc1-c1cccc(CO)c1)C(=O)NCC#N |
| InChI | InChI=1S/C19H23N3O2S/c1-13(2)8-17(19(24)21-7-6-20)22-18-12-25-11-16(18)15-5-3-4-14(9-15)10-23/h3-5,9,11-13,17,22-23H,7-8,10H2,1-2H3,(H,21,24)/t17-/m0/s1 |
| InChIKey | CTYKDAJQLMHSTB-KRWDZBQOSA-N |
| XLogP | 3.37 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|