C16H24N6O2 — CID 10449442
(2S)-N-(cyanomethyl)-4-methyl-2-[(2-morpholin-4-ylpyrimidin-4-yl)amino]pentanamide (PubChem CID 10449442) has the molecular formula C16H24N6O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-4-methyl-2-[(2-morpholin-4-ylpyrimidin-4-yl)amino]pentanamide.
| Compound Name | (2S)-N-(cyanomethyl)-4-methyl-2-[(2-morpholin-4-ylpyrimidin-4-yl)amino]pentanamide |
|---|---|
| PubChem CID | 10449442 |
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (2S)-N-(cyanomethyl)-4-methyl-2-[(2-morpholin-4-ylpyrimidin-4-yl)amino]pentanamide |
| SMILES | CC(C)C[C@H](Nc1ccnc(N2CCOCC2)n1)C(=O)NCC#N |
| InChI | InChI=1S/C16H24N6O2/c1-12(2)11-13(15(23)18-6-4-17)20-14-3-5-19-16(21-14)22-7-9-24-10-8-22/h3,5,12-13H,6-11H2,1-2H3,(H,18,23)(H,19,20,21)/t13-/m0/s1 |
| InChIKey | CYTFRQLBIBUYOW-ZDUSSCGKSA-N |
| XLogP | 0.78 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|