C20H27N7O — CID 10452450
(2S)-N-(cyanomethyl)-4-methyl-2-[[2-[methyl(2-pyridin-2-ylethyl)amino]pyrimidin-4-yl]amino]pentanamide (PubChem CID 10452450) has the molecular formula C20H27N7O and a molecular weight of 381.48 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-4-methyl-2-[[2-[methyl(2-pyridin-2-ylethyl)amino]pyrimidin-4-yl]amino]pentanamide.
| Compound Name | (2S)-N-(cyanomethyl)-4-methyl-2-[[2-[methyl(2-pyridin-2-ylethyl)amino]pyrimidin-4-yl]amino]pentanamide |
|---|---|
| PubChem CID | 10452450 |
| Molecular Formula | C20H27N7O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (2S)-N-(cyanomethyl)-4-methyl-2-[[2-[methyl(2-pyridin-2-ylethyl)amino]pyrimidin-4-yl]amino]pentanamide |
| SMILES | CC(C)C[C@H](Nc1ccnc(N(C)CCc2ccccn2)n1)C(=O)NCC#N |
| InChI | InChI=1S/C20H27N7O/c1-15(2)14-17(19(28)23-12-9-21)25-18-7-11-24-20(26-18)27(3)13-8-16-6-4-5-10-22-16/h4-7,10-11,15,17H,8,12-14H2,1-3H3,(H,23,28)(H,24,25,26)/t17-/m0/s1 |
| InChIKey | BMCDMBRXDQYMQN-KRWDZBQOSA-N |
| XLogP | 2.02 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|