C27H30N4O — CID 59040852
(2R)-N-(cyanomethyl)-4-methyl-2-[3-[4-[(pyridin-2-ylmethylamino)methyl]phenyl]phenyl]pentanamide (PubChem CID 59040852) has the molecular formula C27H30N4O and a molecular weight of 426.56 g/mol. Its IUPAC name is (2R)-N-(cyanomethyl)-4-methyl-2-[3-[4-[(pyridin-2-ylmethylamino)methyl]phenyl]phenyl]pentanamide.
| Compound Name | (2R)-N-(cyanomethyl)-4-methyl-2-[3-[4-[(pyridin-2-ylmethylamino)methyl]phenyl]phenyl]pentanamide |
|---|---|
| PubChem CID | 59040852 |
| Molecular Formula | C27H30N4O |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (2R)-N-(cyanomethyl)-4-methyl-2-[3-[4-[(pyridin-2-ylmethylamino)methyl]phenyl]phenyl]pentanamide |
| SMILES | CC(C)C[C@@H](C(=O)NCC#N)c1cccc(-c2ccc(CNCc3ccccn3)cc2)c1 |
| InChI | InChI=1S/C27H30N4O/c1-20(2)16-26(27(32)31-15-13-28)24-7-5-6-23(17-24)22-11-9-21(10-12-22)18-29-19-25-8-3-4-14-30-25/h3-12,14,17,20,26,29H,15-16,18-19H2,1-2H3,(H,31,32)/t26-/m1/s1 |
| InChIKey | ZAFIOYFKQPAQJF-AREMUKBSSA-N |
| XLogP | 4.81 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|